C17H18O4S — CID 122223436
(E)-4-[3-methoxy-4-(methoxymethoxy)phenyl]-1-thiophen-2-ylbut-3-en-1-one (PubChem CID 122223436) has the molecular formula C17H18O4S and a molecular weight of 318.39 g/mol. Its IUPAC name is (E)-4-[3-methoxy-4-(methoxymethoxy)phenyl]-1-thiophen-2-ylbut-3-en-1-one.
| Compound Name | (E)-4-[3-methoxy-4-(methoxymethoxy)phenyl]-1-thiophen-2-ylbut-3-en-1-one |
|---|---|
| PubChem CID | 122223436 |
| Molecular Formula | C17H18O4S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (E)-4-[3-methoxy-4-(methoxymethoxy)phenyl]-1-thiophen-2-ylbut-3-en-1-one |
| SMILES | COCOc1ccc(/C=C/CC(=O)c2cccs2)cc1OC |
| InChI | InChI=1S/C17H18O4S/c1-19-12-21-15-9-8-13(11-16(15)20-2)5-3-6-14(18)17-7-4-10-22-17/h3-5,7-11H,6,12H2,1-2H3/b5-3+ |
| InChIKey | YXHJDHJRUFVBGQ-HWKANZROSA-N |
| XLogP | 4.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|