C16H18F3NO4S3 — CID 122223526
S-(2,2,2-trifluoroethyl) 2-[(1S)-1-(2-methoxyphenyl)-2-nitroethyl]-1,3-dithiane-2-carbothioate (PubChem CID 122223526) has the molecular formula C16H18F3NO4S3 and a molecular weight of 441.52 g/mol. Its IUPAC name is S-(2,2,2-trifluoroethyl) 2-[(1S)-1-(2-methoxyphenyl)-2-nitroethyl]-1,3-dithiane-2-carbothioate.
| Compound Name | S-(2,2,2-trifluoroethyl) 2-[(1S)-1-(2-methoxyphenyl)-2-nitroethyl]-1,3-dithiane-2-carbothioate |
|---|---|
| PubChem CID | 122223526 |
| Molecular Formula | C16H18F3NO4S3 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | S-(2,2,2-trifluoroethyl) 2-[(1S)-1-(2-methoxyphenyl)-2-nitroethyl]-1,3-dithiane-2-carbothioate |
| SMILES | COc1ccccc1[C@@H](C[N+](=O)[O-])C1(C(=O)SCC(F)(F)F)SCCCS1 |
| InChI | InChI=1S/C16H18F3NO4S3/c1-24-13-6-3-2-5-11(13)12(9-20(22)23)16(26-7-4-8-27-16)14(21)25-10-15(17,18)19/h2-3,5-6,12H,4,7-10H2,1H3/t12-/m1/s1 |
| InChIKey | OVQIUUBAFUGBMP-GFCCVEGCSA-N |
| XLogP | 4.44 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|