C13H12BNO5 — CID 122225554
3-borono-5-(cyclopenta-2,4-diene-1-carbonylamino)benzoic acid (PubChem CID 122225554) has the molecular formula C13H12BNO5 and a molecular weight of 273.05 g/mol. Its IUPAC name is 3-borono-5-(cyclopenta-2,4-diene-1-carbonylamino)benzoic acid.
| Compound Name | 3-borono-5-(cyclopenta-2,4-diene-1-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 122225554 |
| Molecular Formula | C13H12BNO5 |
| Molecular Weight | 273.05 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3-borono-5-(cyclopenta-2,4-diene-1-carbonylamino)benzoic acid |
| SMILES | O=C(O)c1cc(NC(=O)C2C=CC=C2)cc(B(O)O)c1 |
| InChI | InChI=1S/C13H12BNO5/c16-12(8-3-1-2-4-8)15-11-6-9(13(17)18)5-10(7-11)14(19)20/h1-8,19-20H,(H,15,16)(H,17,18) |
| InChIKey | AFHKUVICDBRETI-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.05 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|