C21H19F3N2O — CID 122226601
4-phenyl-5-piperidin-1-yl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole (PubChem CID 122226601) has the molecular formula C21H19F3N2O and a molecular weight of 372.39 g/mol. Its IUPAC name is 4-phenyl-5-piperidin-1-yl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole.
| Compound Name | 4-phenyl-5-piperidin-1-yl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 122226601 |
| Molecular Formula | C21H19F3N2O |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 4-phenyl-5-piperidin-1-yl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole |
| SMILES | FC(F)(F)c1ccc(-c2nc(-c3ccccc3)c(N3CCCCC3)o2)cc1 |
| InChI | InChI=1S/C21H19F3N2O/c22-21(23,24)17-11-9-16(10-12-17)19-25-18(15-7-3-1-4-8-15)20(27-19)26-13-5-2-6-14-26/h1,3-4,7-12H,2,5-6,13-14H2 |
| InChIKey | KALYTVVWFDQKBS-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |