C20H19BrN2O3 — CID 122226619
2-[[(3S)-5-bromo-3-hydroxy-1-methyl-2-oxoindol-3-yl]methyl]-N-(4-methylphenyl)prop-2-enamide (PubChem CID 122226619) has the molecular formula C20H19BrN2O3 and a molecular weight of 415.29 g/mol. Its IUPAC name is 2-[[(3S)-5-bromo-3-hydroxy-1-methyl-2-oxoindol-3-yl]methyl]-N-(4-methylphenyl)prop-2-enamide.
| Compound Name | 2-[[(3S)-5-bromo-3-hydroxy-1-methyl-2-oxoindol-3-yl]methyl]-N-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 122226619 |
| Molecular Formula | C20H19BrN2O3 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 2-[[(3S)-5-bromo-3-hydroxy-1-methyl-2-oxoindol-3-yl]methyl]-N-(4-methylphenyl)prop-2-enamide |
| SMILES | C=C(C[C@@]1(O)C(=O)N(C)c2ccc(Br)cc21)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C20H19BrN2O3/c1-12-4-7-15(8-5-12)22-18(24)13(2)11-20(26)16-10-14(21)6-9-17(16)23(3)19(20)25/h4-10,26H,2,11H2,1,3H3,(H,22,24)/t20-/m0/s1 |
| InChIKey | XKFGZSNUEQNAAN-FQEVSTJZSA-N |
| XLogP | 3.51 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|