C19H15BrF3NO2S — CID 122227607
N-(2-bromo-1-naphthalen-2-ylethyl)-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 122227607) has the molecular formula C19H15BrF3NO2S and a molecular weight of 458.30 g/mol. Its IUPAC name is N-(2-bromo-1-naphthalen-2-ylethyl)-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-bromo-1-naphthalen-2-ylethyl)-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 122227607 |
| Molecular Formula | C19H15BrF3NO2S |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 457.00 |
| IUPAC Name | N-(2-bromo-1-naphthalen-2-ylethyl)-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NC(CBr)c1ccc2ccccc2c1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15BrF3NO2S/c20-12-18(15-6-5-13-3-1-2-4-14(13)11-15)24-27(25,26)17-9-7-16(8-10-17)19(21,22)23/h1-11,18,24H,12H2 |
| InChIKey | BMYQVZLEFLELSC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|