C22H17F6NO2S — CID 163444652
N-[(1S)-1,2-diphenylethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 163444652) has the molecular formula C22H17F6NO2S and a molecular weight of 473.44 g/mol. Its IUPAC name is N-[(1S)-1,2-diphenylethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(1S)-1,2-diphenylethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 163444652 |
| Molecular Formula | C22H17F6NO2S |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | N-[(1S)-1,2-diphenylethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H](Cc1ccccc1)c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H17F6NO2S/c23-21(24,25)17-12-18(22(26,27)28)14-19(13-17)32(30,31)29-20(16-9-5-2-6-10-16)11-15-7-3-1-4-8-15/h1-10,12-14,20,29H,11H2/t20-/m0/s1 |
| InChIKey | BBMBNRUBUYBBTF-FQEVSTJZSA-N |
| XLogP | 5.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |