C16H16F3NO — CID 82712825
1,2-diphenyl-N-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 82712825) has the molecular formula C16H16F3NO and a molecular weight of 295.30 g/mol. Its IUPAC name is 1,2-diphenyl-N-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | 1,2-diphenyl-N-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 82712825 |
| Molecular Formula | C16H16F3NO |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1,2-diphenyl-N-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | FC(F)(F)CONC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16F3NO/c17-16(18,19)12-21-20-15(14-9-5-2-6-10-14)11-13-7-3-1-4-8-13/h1-10,15,20H,11-12H2 |
| InChIKey | OMAAQXZPKPOBSZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|