C31H59BO6Si2 — CID 122228006
[(Z,2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-5-en-3-yl] (2E)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]penta-2,4-dienoate (PubChem CID 122228006) has the molecular formula C31H59BO6Si2 and a molecular weight of 594.79 g/mol. Its IUPAC name is [(Z,2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-5-en-3-yl] (2E)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]penta-2,4-dienoate.
| Compound Name | [(Z,2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-5-en-3-yl] (2E)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 122228006 |
| Molecular Formula | C31H59BO6Si2 |
| Molecular Weight | 594.79 g/mol |
| Exact Mass | 594.39 |
| IUPAC Name | [(Z,2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-5-en-3-yl] (2E)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]penta-2,4-dienoate |
| SMILES | C=C/C=C(\CO[Si](C)(C)C(C)(C)C)C(=O)O[C@@H](C/C=C(\C)B1OC(C)(C)C(C)(C)O1)C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H59BO6Si2/c1-18-19-25(22-34-39(14,15)28(4,5)6)27(33)35-26(24(3)36-40(16,17)29(7,8)9)21-20-23(2)32-37-30(10,11)31(12,13)38-32/h18-20,24,26H,1,21-22H2,2-17H3/b23-20+,25-19+/t24?,26-/m0/s1 |
| InChIKey | RAVMUMNIXRFHSO-VSRDVYRXSA-N |
| XLogP | 8.41 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.79 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|