C36H73BO7Si3 — CID 46933712
ethyl (2E,4R,5R,7R,8Z)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-bis(triethylsilyloxy)nona-2,8-dienoate (PubChem CID 46933712) has the molecular formula C36H73BO7Si3 and a molecular weight of 713.04 g/mol. Its IUPAC name is ethyl (2E,4R,5R,7R,8Z)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-bis(triethylsilyloxy)nona-2,8-dienoate.
| Compound Name | ethyl (2E,4R,5R,7R,8Z)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-bis(triethylsilyloxy)nona-2,8-dienoate |
|---|---|
| PubChem CID | 46933712 |
| Molecular Formula | C36H73BO7Si3 |
| Molecular Weight | 713.04 g/mol |
| Exact Mass | 712.48 |
| IUPAC Name | ethyl (2E,4R,5R,7R,8Z)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-bis(triethylsilyloxy)nona-2,8-dienoate |
| SMILES | CCOC(=O)/C=C/[C@@](C)(O[Si](CC)(CC)CC)[C@@H](C[C@H](/C=C\B1OC(C)(C)C(C)(C)O1)O[Si](C)(C)C(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C36H73BO7Si3/c1-18-39-32(38)25-27-36(15,44-47(22-5,23-6)24-7)31(41-46(19-2,20-3)21-4)29-30(40-45(16,17)33(8,9)10)26-28-37-42-34(11,12)35(13,14)43-37/h25-28,30-31H,18-24,29H2,1-17H3/b27-25+,28-26-/t30-,31+,36+/m0/s1 |
| InChIKey | OCGANXSSMCTRIB-YHFSRTLOSA-N |
| XLogP | 10.24 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.04 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|