C21H41BO5Si — CID 154712928
ethyl (E)-7-[tert-butyl(dimethyl)silyl]oxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-2-enoate (PubChem CID 154712928) has the molecular formula C21H41BO5Si and a molecular weight of 412.45 g/mol. Its IUPAC name is ethyl (E)-7-[tert-butyl(dimethyl)silyl]oxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-2-enoate.
| Compound Name | ethyl (E)-7-[tert-butyl(dimethyl)silyl]oxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-2-enoate |
|---|---|
| PubChem CID | 154712928 |
| Molecular Formula | C21H41BO5Si |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | ethyl (E)-7-[tert-butyl(dimethyl)silyl]oxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-2-enoate |
| SMILES | CCOC(=O)/C=C(/CCCCO[Si](C)(C)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H41BO5Si/c1-11-24-18(23)16-17(22-26-20(5,6)21(7,8)27-22)14-12-13-15-25-28(9,10)19(2,3)4/h16H,11-15H2,1-10H3/b17-16- |
| InChIKey | OSFVMIKPBIMTLK-MSUUIHNZSA-N |
| XLogP | 5.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|