C21H39BO5Si — CID 11625693
methyl (2E,4S,5S,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,6-dienoate (PubChem CID 11625693) has the molecular formula C21H39BO5Si and a molecular weight of 410.44 g/mol. Its IUPAC name is methyl (2E,4S,5S,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,6-dienoate.
| Compound Name | methyl (2E,4S,5S,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,6-dienoate |
|---|---|
| PubChem CID | 11625693 |
| Molecular Formula | C21H39BO5Si |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | methyl (2E,4S,5S,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,6-dienoate |
| SMILES | COC(=O)/C=C/[C@H](C)[C@H](/C=C/B1OC(C)(C)C(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H39BO5Si/c1-16(12-13-18(23)24-9)17(25-28(10,11)19(2,3)4)14-15-22-26-20(5,6)21(7,8)27-22/h12-17H,1-11H3/b13-12+,15-14+/t16-,17-/m0/s1 |
| InChIKey | OZUOHWLJWPVMKD-YUFATILMSA-N |
| XLogP | 4.93 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|