C25H45BO5Si — CID 101462909
ethyl (2E,4S,5S,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nona-2,6,8-trienoate (PubChem CID 101462909) has the molecular formula C25H45BO5Si and a molecular weight of 464.53 g/mol. Its IUPAC name is ethyl (2E,4S,5S,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nona-2,6,8-trienoate.
| Compound Name | ethyl (2E,4S,5S,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nona-2,6,8-trienoate |
|---|---|
| PubChem CID | 101462909 |
| Molecular Formula | C25H45BO5Si |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | ethyl (2E,4S,5S,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nona-2,6,8-trienoate |
| SMILES | CCOC(=O)/C=C/[C@H](C)[C@H](/C=C/C(C)=C/B1OC(C)(C)C(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H45BO5Si/c1-13-28-22(27)17-15-20(3)21(29-32(11,12)23(4,5)6)16-14-19(2)18-26-30-24(7,8)25(9,10)31-26/h14-18,20-21H,13H2,1-12H3/b16-14+,17-15+,19-18+/t20-,21-/m0/s1 |
| InChIKey | XXPLYKIOFHACDB-GJSAKYKRSA-N |
| XLogP | 6.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|