C19H34O3Si — CID 101488817
ethyl (2E,4S,5R,6E,8E)-4-methyl-5-triethylsilyloxydeca-2,6,8-trienoate (PubChem CID 101488817) has the molecular formula C19H34O3Si and a molecular weight of 338.56 g/mol. Its IUPAC name is ethyl (2E,4S,5R,6E,8E)-4-methyl-5-triethylsilyloxydeca-2,6,8-trienoate.
| Compound Name | ethyl (2E,4S,5R,6E,8E)-4-methyl-5-triethylsilyloxydeca-2,6,8-trienoate |
|---|---|
| PubChem CID | 101488817 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | ethyl (2E,4S,5R,6E,8E)-4-methyl-5-triethylsilyloxydeca-2,6,8-trienoate |
| SMILES | C/C=C/C=C/[C@@H](O[Si](CC)(CC)CC)[C@@H](C)/C=C/C(=O)OCC |
| InChI | InChI=1S/C19H34O3Si/c1-7-12-13-14-18(22-23(9-3,10-4)11-5)17(6)15-16-19(20)21-8-2/h7,12-18H,8-11H2,1-6H3/b12-7+,14-13+,16-15+/t17-,18+/m0/s1 |
| InChIKey | VSWSGXZBRFVDDZ-MISLCUHNSA-N |
| XLogP | 5.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|