C22H41BO5Si — CID 102396890
[(E)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylidene-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-3-enyl] acetate (PubChem CID 102396890) has the molecular formula C22H41BO5Si and a molecular weight of 424.46 g/mol. Its IUPAC name is [(E)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylidene-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-3-enyl] acetate.
| Compound Name | [(E)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylidene-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-3-enyl] acetate |
|---|---|
| PubChem CID | 102396890 |
| Molecular Formula | C22H41BO5Si |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | [(E)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylidene-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-3-enyl] acetate |
| SMILES | C=C(/C(=C/CCOC(C)=O)B1OC(C)(C)C(C)(C)O1)C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H41BO5Si/c1-16(17(2)26-29(11,12)20(4,5)6)19(14-13-15-25-18(3)24)23-27-21(7,8)22(9,10)28-23/h14,17H,1,13,15H2,2-12H3/b19-14- |
| InChIKey | IDGZPHLERORMLE-RGEXLXHISA-N |
| XLogP | 5.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|