C22H41BO5Si — CID 102464415
ethyl (2E,4S,5S,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,6-dienoate (PubChem CID 102464415) has the molecular formula C22H41BO5Si and a molecular weight of 424.46 g/mol. Its IUPAC name is ethyl (2E,4S,5S,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,6-dienoate.
| Compound Name | ethyl (2E,4S,5S,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,6-dienoate |
|---|---|
| PubChem CID | 102464415 |
| Molecular Formula | C22H41BO5Si |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | ethyl (2E,4S,5S,6E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,6-dienoate |
| SMILES | CCOC(=O)/C=C/[C@H](C)[C@H](/C=C/B1OC(C)(C)C(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H41BO5Si/c1-12-25-19(24)14-13-17(2)18(26-29(10,11)20(3,4)5)15-16-23-27-21(6,7)22(8,9)28-23/h13-18H,12H2,1-11H3/b14-13+,16-15+/t17-,18-/m0/s1 |
| InChIKey | NHVDQHCFJICOJN-MZZLSCLLSA-N |
| XLogP | 5.32 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|