C22H44O4Si2 — CID 10094120
ethyl (2E,4S,5S,6E)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienoate (PubChem CID 10094120) has the molecular formula C22H44O4Si2 and a molecular weight of 428.76 g/mol. Its IUPAC name is ethyl (2E,4S,5S,6E)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienoate.
| Compound Name | ethyl (2E,4S,5S,6E)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienoate |
|---|---|
| PubChem CID | 10094120 |
| Molecular Formula | C22H44O4Si2 |
| Molecular Weight | 428.76 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | ethyl (2E,4S,5S,6E)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienoate |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C/C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O4Si2/c1-13-15-18(25-27(9,10)21(3,4)5)19(16-17-20(23)24-14-2)26-28(11,12)22(6,7)8/h13,15-19H,14H2,1-12H3/b15-13+,17-16+/t18-,19-/m0/s1 |
| InChIKey | SUTXVNOBJHNRAR-BJOJTJGCSA-N |
| XLogP | 6.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.76 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|