C24H46O6Si2 — CID 11027326
diethyl (2E,4R,5R,6E)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienedioate (PubChem CID 11027326) has the molecular formula C24H46O6Si2 and a molecular weight of 486.80 g/mol. Its IUPAC name is diethyl (2E,4R,5R,6E)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienedioate.
| Compound Name | diethyl (2E,4R,5R,6E)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienedioate |
|---|---|
| PubChem CID | 11027326 |
| Molecular Formula | C24H46O6Si2 |
| Molecular Weight | 486.80 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | diethyl (2E,4R,5R,6E)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienedioate |
| SMILES | CCOC(=O)/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](/C=C/C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O6Si2/c1-13-27-21(25)17-15-19(29-31(9,10)23(3,4)5)20(16-18-22(26)28-14-2)30-32(11,12)24(6,7)8/h15-20H,13-14H2,1-12H3/b17-15+,18-16+/t19-,20-/m1/s1 |
| InChIKey | GDMVSENXIZFNJM-AZBDOTAUSA-N |
| XLogP | 6.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.80 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|