C22H40O5Si — CID 90803595
tert-butyl (5S)-5-[(5S)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoyl]oxyhex-2-enoate (PubChem CID 90803595) has the molecular formula C22H40O5Si and a molecular weight of 412.64 g/mol. Its IUPAC name is tert-butyl (5S)-5-[(5S)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoyl]oxyhex-2-enoate.
| Compound Name | tert-butyl (5S)-5-[(5S)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoyl]oxyhex-2-enoate |
|---|---|
| PubChem CID | 90803595 |
| Molecular Formula | C22H40O5Si |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | tert-butyl (5S)-5-[(5S)-5-[tert-butyl(dimethyl)silyl]oxyhex-2-enoyl]oxyhex-2-enoate |
| SMILES | C[C@@H](CC=CC(=O)OC(C)(C)C)OC(=O)C=CC[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O5Si/c1-17(13-11-16-20(24)26-21(3,4)5)25-19(23)15-12-14-18(2)27-28(9,10)22(6,7)8/h11-12,15-18H,13-14H2,1-10H3/t17-,18-/m0/s1 |
| InChIKey | BBYZZJZFSKCGQW-ROUUACIJSA-N |
| XLogP | 5.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|