C35H65BO6Si2 — CID 177498678
ethyl (2E,4E,7R,8R,9R,10Z,12E)-4,8-dimethyl-13-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,9-bis(triethylsilyloxy)trideca-2,4,10,12-tetraenoate (PubChem CID 177498678) has the molecular formula C35H65BO6Si2 and a molecular weight of 648.88 g/mol. Its IUPAC name is ethyl (2E,4E,7R,8R,9R,10Z,12E)-4,8-dimethyl-13-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,9-bis(triethylsilyloxy)trideca-2,4,10,12-tetraenoate.
| Compound Name | ethyl (2E,4E,7R,8R,9R,10Z,12E)-4,8-dimethyl-13-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,9-bis(triethylsilyloxy)trideca-2,4,10,12-tetraenoate |
|---|---|
| PubChem CID | 177498678 |
| Molecular Formula | C35H65BO6Si2 |
| Molecular Weight | 648.88 g/mol |
| Exact Mass | 648.44 |
| IUPAC Name | ethyl (2E,4E,7R,8R,9R,10Z,12E)-4,8-dimethyl-13-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7,9-bis(triethylsilyloxy)trideca-2,4,10,12-tetraenoate |
| SMILES | CCOC(=O)/C=C/C(C)=C/C[C@@H](O[Si](CC)(CC)CC)[C@@H](C)[C@@H](/C=C\C=C\B1OC(C)(C)C(C)(C)O1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C35H65BO6Si2/c1-14-38-33(37)27-25-29(8)24-26-32(40-44(18-5,19-6)20-7)30(9)31(39-43(15-2,16-3)17-4)23-21-22-28-36-41-34(10,11)35(12,13)42-36/h21-25,27-28,30-32H,14-20,26H2,1-13H3/b23-21-,27-25+,28-22+,29-24+/t30-,31+,32+/m0/s1 |
| InChIKey | XGNSDXGLTNIOJR-GNPGDHLZSA-N |
| XLogP | 9.60 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.88 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|