C12H13I — CID 122229911
1-[(3R)-hexa-1,5-dien-3-yl]-2-iodobenzene (PubChem CID 122229911) has the molecular formula C12H13I and a molecular weight of 284.14 g/mol. Its IUPAC name is 1-[(3R)-hexa-1,5-dien-3-yl]-2-iodobenzene.
| Compound Name | 1-[(3R)-hexa-1,5-dien-3-yl]-2-iodobenzene |
|---|---|
| PubChem CID | 122229911 |
| Molecular Formula | C12H13I |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 1-[(3R)-hexa-1,5-dien-3-yl]-2-iodobenzene |
| SMILES | C=CC[C@H](C=C)c1ccccc1I |
| InChI | InChI=1S/C12H13I/c1-3-7-10(4-2)11-8-5-6-9-12(11)13/h3-6,8-10H,1-2,7H2/t10-/m0/s1 |
| InChIKey | USMDXMGFXVWPTP-JTQLQIEISA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|