C28H28N2O5 — CID 122231017
2-[3-(1,3-dioxoisoindol-2-yl)-6-(2-oxocyclohexyl)hexyl]isoindole-1,3-dione (PubChem CID 122231017) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is 2-[3-(1,3-dioxoisoindol-2-yl)-6-(2-oxocyclohexyl)hexyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(1,3-dioxoisoindol-2-yl)-6-(2-oxocyclohexyl)hexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122231017 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 2-[3-(1,3-dioxoisoindol-2-yl)-6-(2-oxocyclohexyl)hexyl]isoindole-1,3-dione |
| SMILES | O=C1CCCCC1CCCC(CCN1C(=O)c2ccccc2C1=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H28N2O5/c31-24-15-6-1-8-18(24)9-7-10-19(30-27(34)22-13-4-5-14-23(22)28(30)35)16-17-29-25(32)20-11-2-3-12-21(20)26(29)33/h2-5,11-14,18-19H,1,6-10,15-17H2 |
| InChIKey | YEGYCDMUAXWWEB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|