About 2-(4,6-dimethylheptyl)cyclohexan-1-one
2-(4,6-dimethylheptyl)cyclohexan-1-one (PubChem CID 174893690) has the molecular formula C15H28O
and a molecular weight of 224.39 g/mol. Its IUPAC name is 2-(4,6-dimethylheptyl)cyclohexan-1-one.
Molecular Properties
| Compound Name | 2-(4,6-dimethylheptyl)cyclohexan-1-one |
| PubChem CID | 174893690 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 2-(4,6-dimethylheptyl)cyclohexan-1-one |
| SMILES | CC(C)CC(C)CCCC1CCCCC1=O |
| InChI | InChI=1S/C15H28O/c1-12(2)11-13(3)7-6-9-14-8-4-5-10-15(14)16/h12-14H,4-11H2,1-3H3 |
| InChIKey | JSAMWLYWZWVCHP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4,6-dimethylheptyl)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethylheptyl)cyclohexan-1-one?
The IUPAC name of 2-(4,6-dimethylheptyl)cyclohexan-1-one (CID 174893690) is 2-(4,6-dimethylheptyl)cyclohexan-1-one.
What is the SMILES notation for 2-(4,6-dimethylheptyl)cyclohexan-1-one?
The canonical SMILES for 2-(4,6-dimethylheptyl)cyclohexan-1-one is CC(C)CC(C)CCCC1CCCCC1=O.
What is the InChIKey of 2-(4,6-dimethylheptyl)cyclohexan-1-one?
The InChIKey is JSAMWLYWZWVCHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O/c1-12(2)11-13(3)7-6-9-14-8-4-5-10-15(14)16/h12-14H,4-11H2,1-3H3.
What are the key properties of 2-(4,6-dimethylheptyl)cyclohexan-1-one?
2-(4,6-dimethylheptyl)cyclohexan-1-one has a molecular weight of 224.39 g/mol, XLogP of 4.60, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethylheptyl)cyclohexan-1-one is sourced from PubChem (CID 174893690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).