C18H23N3O4S — CID 122231255
N-(2-methyl-2-pyridin-2-ylhexyl)-2-nitrobenzenesulfonamide (PubChem CID 122231255) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-(2-methyl-2-pyridin-2-ylhexyl)-2-nitrobenzenesulfonamide.
| Compound Name | N-(2-methyl-2-pyridin-2-ylhexyl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122231255 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-(2-methyl-2-pyridin-2-ylhexyl)-2-nitrobenzenesulfonamide |
| SMILES | CCCCC(C)(CNS(=O)(=O)c1ccccc1[N+](=O)[O-])c1ccccn1 |
| InChI | InChI=1S/C18H23N3O4S/c1-3-4-12-18(2,17-11-7-8-13-19-17)14-20-26(24,25)16-10-6-5-9-15(16)21(22)23/h5-11,13,20H,3-4,12,14H2,1-2H3 |
| InChIKey | ZCPSHRQTEIASBQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|