C13H27B2O5- — CID 122232341
2-methoxy-4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dioxa-2-boranuidacyclopentane (PubChem CID 122232341) has the molecular formula C13H27B2O5- and a molecular weight of 284.98 g/mol. Its IUPAC name is 2-methoxy-4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dioxa-2-boranuidacyclopentane.
| Compound Name | 2-methoxy-4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dioxa-2-boranuidacyclopentane |
|---|---|
| PubChem CID | 122232341 |
| Molecular Formula | C13H27B2O5- |
| Molecular Weight | 284.98 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 2-methoxy-4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dioxa-2-boranuidacyclopentane |
| SMILES | CO[B-]1(B2OC(C)(C)C(C)(C)O2)OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H27B2O5/c1-10(2)11(3,4)18-14(17-10)15(16-9)19-12(5,6)13(7,8)20-15/h1-9H3/q-1 |
| InChIKey | PMECEWLAVFQEDE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.98 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|