C12H24B2FO4- — CID 134862517
2-fluoro-4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dioxa-2-boranuidacyclopentane (PubChem CID 134862517) has the molecular formula C12H24B2FO4- and a molecular weight of 272.94 g/mol. Its IUPAC name is 2-fluoro-4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dioxa-2-boranuidacyclopentane.
| Compound Name | 2-fluoro-4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dioxa-2-boranuidacyclopentane |
|---|---|
| PubChem CID | 134862517 |
| Molecular Formula | C12H24B2FO4- |
| Molecular Weight | 272.94 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | 2-fluoro-4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-dioxa-2-boranuidacyclopentane |
| SMILES | CC1(C)OB([B-]2(F)OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C12H24B2FO4/c1-9(2)10(3,4)17-13(16-9)14(15)18-11(5,6)12(7,8)19-14/h1-8H3/q-1 |
| InChIKey | AVXOWEWKLUAQOW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.94 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|