C15H8Cl2F2N2 — CID 122232619
3,5-bis(4-chlorophenyl)-4,4-difluoropyrazole (PubChem CID 122232619) has the molecular formula C15H8Cl2F2N2 and a molecular weight of 325.15 g/mol. Its IUPAC name is 3,5-bis(4-chlorophenyl)-4,4-difluoropyrazole.
| Compound Name | 3,5-bis(4-chlorophenyl)-4,4-difluoropyrazole |
|---|---|
| PubChem CID | 122232619 |
| Molecular Formula | C15H8Cl2F2N2 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 3,5-bis(4-chlorophenyl)-4,4-difluoropyrazole |
| SMILES | FC1(F)C(c2ccc(Cl)cc2)=NN=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H8Cl2F2N2/c16-11-5-1-9(2-6-11)13-15(18,19)14(21-20-13)10-3-7-12(17)8-4-10/h1-8H |
| InChIKey | JFHYUWOZFATBKQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |