C22H18F3N3O — CID 122232635
4-methyl-2-[(3-methylphenyl)diazenyl]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 122232635) has the molecular formula C22H18F3N3O and a molecular weight of 397.40 g/mol. Its IUPAC name is 4-methyl-2-[(3-methylphenyl)diazenyl]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-methyl-2-[(3-methylphenyl)diazenyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 122232635 |
| Molecular Formula | C22H18F3N3O |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 4-methyl-2-[(3-methylphenyl)diazenyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1cccc(/N=N/c2cc(C)ccc2C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C22H18F3N3O/c1-14-5-3-8-18(11-14)27-28-20-12-15(2)9-10-19(20)21(29)26-17-7-4-6-16(13-17)22(23,24)25/h3-13H,1-2H3,(H,26,29)/b28-27+ |
| InChIKey | AQCULQOBELRXAV-BYYHNAKLSA-N |
| XLogP | 6.99 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|