C22H19F3N4O — CID 134102708
1-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 134102708) has the molecular formula C22H19F3N4O and a molecular weight of 412.42 g/mol. Its IUPAC name is 1-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 134102708 |
| Molecular Formula | C22H19F3N4O |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 1-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1ccccc1/N=N/c1ccc(NC(=O)Nc2cccc(C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C22H19F3N4O/c1-14-6-3-4-9-20(14)29-28-18-10-11-19(15(2)12-18)27-21(30)26-17-8-5-7-16(13-17)22(23,24)25/h3-13H,1-2H3,(H2,26,27,30)/b29-28+ |
| InChIKey | YYHGSRRASSBHMI-ZQHSETAFSA-N |
| XLogP | 7.38 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|