C17H7F6N — CID 122233527
2,3,4,5,6-pentafluoro-N-naphthalen-1-ylbenzenecarboximidoyl fluoride (PubChem CID 122233527) has the molecular formula C17H7F6N and a molecular weight of 339.24 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-naphthalen-1-ylbenzenecarboximidoyl fluoride.
| Compound Name | 2,3,4,5,6-pentafluoro-N-naphthalen-1-ylbenzenecarboximidoyl fluoride |
|---|---|
| PubChem CID | 122233527 |
| Molecular Formula | C17H7F6N |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-naphthalen-1-ylbenzenecarboximidoyl fluoride |
| SMILES | F/C(=N\c1cccc2ccccc12)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H7F6N/c18-12-11(13(19)15(21)16(22)14(12)20)17(23)24-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H/b24-17- |
| InChIKey | VHEOBPLAORXCTL-ULJHMMPZSA-N |
| XLogP | 5.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|