C12H7F3IN — CID 139894364
2,2,2-trifluoro-N-naphthalen-1-ylethanimidoyl iodide (PubChem CID 139894364) has the molecular formula C12H7F3IN and a molecular weight of 349.09 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-naphthalen-1-ylethanimidoyl iodide.
| Compound Name | 2,2,2-trifluoro-N-naphthalen-1-ylethanimidoyl iodide |
|---|---|
| PubChem CID | 139894364 |
| Molecular Formula | C12H7F3IN |
| Molecular Weight | 349.09 g/mol |
| Exact Mass | 348.96 |
| IUPAC Name | 2,2,2-trifluoro-N-naphthalen-1-ylethanimidoyl iodide |
| SMILES | FC(F)(F)/C(I)=N/c1cccc2ccccc12 |
| InChI | InChI=1S/C12H7F3IN/c13-12(14,15)11(16)17-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H/b17-11- |
| InChIKey | NHQJOGXVTFOTCX-BOPFTXTBSA-N |
| XLogP | 4.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.09 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|