C18H16ClN3O3 — CID 122233773
2-[[4-(3-chloropropyl)triazol-1-yl]methyl]-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione (PubChem CID 122233773) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is 2-[[4-(3-chloropropyl)triazol-1-yl]methyl]-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione.
| Compound Name | 2-[[4-(3-chloropropyl)triazol-1-yl]methyl]-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione |
|---|---|
| PubChem CID | 122233773 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-[[4-(3-chloropropyl)triazol-1-yl]methyl]-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione |
| SMILES | O=C1C(=O)c2ccccc2C2=C1CC(Cn1cc(CCCCl)nn1)O2 |
| InChI | InChI=1S/C18H16ClN3O3/c19-7-3-4-11-9-22(21-20-11)10-12-8-15-17(24)16(23)13-5-1-2-6-14(13)18(15)25-12/h1-2,5-6,9,12H,3-4,7-8,10H2 |
| InChIKey | ZUHUNEOCDGRKBT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|