C19H24ClN3O4 — CID 102456650
(3aS,5R,6R,6aR)-5-[[4-(3-chloropropyl)triazol-1-yl]methyl]-2,2-dimethyl-6-phenyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol (PubChem CID 102456650) has the molecular formula C19H24ClN3O4 and a molecular weight of 393.87 g/mol. Its IUPAC name is (3aS,5R,6R,6aR)-5-[[4-(3-chloropropyl)triazol-1-yl]methyl]-2,2-dimethyl-6-phenyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aS,5R,6R,6aR)-5-[[4-(3-chloropropyl)triazol-1-yl]methyl]-2,2-dimethyl-6-phenyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 102456650 |
| Molecular Formula | C19H24ClN3O4 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (3aS,5R,6R,6aR)-5-[[4-(3-chloropropyl)triazol-1-yl]methyl]-2,2-dimethyl-6-phenyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@@H]2O[C@H](Cn3cc(CCCCl)nn3)[C@](O)(c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C19H24ClN3O4/c1-18(2)26-16-17(27-18)25-15(19(16,24)13-7-4-3-5-8-13)12-23-11-14(21-22-23)9-6-10-20/h3-5,7-8,11,15-17,24H,6,9-10,12H2,1-2H3/t15-,16+,17+,19-/m1/s1 |
| InChIKey | FIZHIFKVRPJTQX-VUHPKUFZSA-N |
| XLogP | 2.21 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|