C11H11F4N3O3S — CID 122244036
3,3,3-trifluoro-N-(5-fluoro-1,3-dimethyl-2,2-dioxo-2λ6,1,3-benzothiadiazol-6-yl)propanamide (PubChem CID 122244036) has the molecular formula C11H11F4N3O3S and a molecular weight of 341.29 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-(5-fluoro-1,3-dimethyl-2,2-dioxo-2λ6,1,3-benzothiadiazol-6-yl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-(5-fluoro-1,3-dimethyl-2,2-dioxo-2λ6,1,3-benzothiadiazol-6-yl)propanamide |
|---|---|
| PubChem CID | 122244036 |
| Molecular Formula | C11H11F4N3O3S |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 3,3,3-trifluoro-N-(5-fluoro-1,3-dimethyl-2,2-dioxo-2λ6,1,3-benzothiadiazol-6-yl)propanamide |
| SMILES | CN1c2cc(F)c(NC(=O)CC(F)(F)F)cc2N(C)S1(=O)=O |
| InChI | InChI=1S/C11H11F4N3O3S/c1-17-8-3-6(12)7(16-10(19)5-11(13,14)15)4-9(8)18(2)22(17,20)21/h3-4H,5H2,1-2H3,(H,16,19) |
| InChIKey | AKTJDVMNPRTTHL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |