C18H17F3N4O2 — CID 122246040
1-[[5-(2-oxopyrrolidin-1-yl)-3-pyridinyl]methyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 122246040) has the molecular formula C18H17F3N4O2 and a molecular weight of 378.35 g/mol. Its IUPAC name is 1-[[5-(2-oxopyrrolidin-1-yl)-3-pyridinyl]methyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[[5-(2-oxopyrrolidin-1-yl)-3-pyridinyl]methyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 122246040 |
| Molecular Formula | C18H17F3N4O2 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 1-[[5-(2-oxopyrrolidin-1-yl)-3-pyridinyl]methyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCc1cncc(N2CCCC2=O)c1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F3N4O2/c19-18(20,21)13-3-5-14(6-4-13)24-17(27)23-10-12-8-15(11-22-9-12)25-7-1-2-16(25)26/h3-6,8-9,11H,1-2,7,10H2,(H2,23,24,27) |
| InChIKey | WETPPJQEEVRTGK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |