C14H12F3N3O3S2 — CID 122251042
3-[2-oxo-2-[3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 122251042) has the molecular formula C14H12F3N3O3S2 and a molecular weight of 391.40 g/mol. Its IUPAC name is 3-[2-oxo-2-[3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[2-oxo-2-[3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 122251042 |
| Molecular Formula | C14H12F3N3O3S2 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 3-[2-oxo-2-[3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C(CN1C(=O)CSC1=S)N1CC(Oc2ncccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C14H12F3N3O3S2/c15-14(16,17)9-2-1-3-18-12(9)23-8-4-19(5-8)10(21)6-20-11(22)7-25-13(20)24/h1-3,8H,4-7H2 |
| InChIKey | UDQSLMZUAJIYBN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|