C21H21N3O3S — CID 122264692
(E)-3-(1,3-benzodioxol-5-yl)-N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-2-ylethyl]prop-2-enamide (PubChem CID 122264692) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-2-ylethyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-2-ylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 122264692 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-2-ylethyl]prop-2-enamide |
| SMILES | Cc1cc(C)n(C(CNC(=O)/C=C/c2ccc3c(c2)OCO3)c2cccs2)n1 |
| InChI | InChI=1S/C21H21N3O3S/c1-14-10-15(2)24(23-14)17(20-4-3-9-28-20)12-22-21(25)8-6-16-5-7-18-19(11-16)27-13-26-18/h3-11,17H,12-13H2,1-2H3,(H,22,25)/b8-6+ |
| InChIKey | IQKZSCYSUUXXHV-SOFGYWHQSA-N |
| XLogP | 3.71 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|