C20H19F3N4O5 — CID 122268674
2-[1-(8-methoxy-2-oxochromene-3-carbonyl)piperidin-4-yl]-4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-one (PubChem CID 122268674) has the molecular formula C20H19F3N4O5 and a molecular weight of 452.39 g/mol. Its IUPAC name is 2-[1-(8-methoxy-2-oxochromene-3-carbonyl)piperidin-4-yl]-4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-one.
| Compound Name | 2-[1-(8-methoxy-2-oxochromene-3-carbonyl)piperidin-4-yl]-4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 122268674 |
| Molecular Formula | C20H19F3N4O5 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 2-[1-(8-methoxy-2-oxochromene-3-carbonyl)piperidin-4-yl]-4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-one |
| SMILES | COc1cccc2cc(C(=O)N3CCC(n4nc(C(F)(F)F)n(C)c4=O)CC3)c(=O)oc12 |
| InChI | InChI=1S/C20H19F3N4O5/c1-25-18(20(21,22)23)24-27(19(25)30)12-6-8-26(9-7-12)16(28)13-10-11-4-3-5-14(31-2)15(11)32-17(13)29/h3-5,10,12H,6-9H2,1-2H3 |
| InChIKey | HTWHBMVDHCUPMA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 99.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|