C25H23N7O2 — CID 122293162
N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-3-phenyl-2,1-benzoxazole-5-carboxamide (PubChem CID 122293162) has the molecular formula C25H23N7O2 and a molecular weight of 453.51 g/mol. Its IUPAC name is N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-3-phenyl-2,1-benzoxazole-5-carboxamide.
| Compound Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-3-phenyl-2,1-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 122293162 |
| Molecular Formula | C25H23N7O2 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]-3-phenyl-2,1-benzoxazole-5-carboxamide |
| SMILES | Cc1cc(C)n(-c2ccc(NCCNC(=O)c3ccc4noc(-c5ccccc5)c4c3)nn2)n1 |
| InChI | InChI=1S/C25H23N7O2/c1-16-14-17(2)32(30-16)23-11-10-22(28-29-23)26-12-13-27-25(33)19-8-9-21-20(15-19)24(34-31-21)18-6-4-3-5-7-18/h3-11,14-15H,12-13H2,1-2H3,(H,26,28)(H,27,33) |
| InChIKey | OEYVQRYUCSQQDI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|