C21H23N7O2S2 — CID 122296928
N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 122296928) has the molecular formula C21H23N7O2S2 and a molecular weight of 469.60 g/mol. Its IUPAC name is N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 122296928 |
| Molecular Formula | C21H23N7O2S2 |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | N-[4-[[6-(diethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | CCN(CC)c1cc(Nc2ccc(NS(=O)(=O)c3cccc4nsnc34)cc2)nc(C)n1 |
| InChI | InChI=1S/C21H23N7O2S2/c1-4-28(5-2)20-13-19(22-14(3)23-20)24-15-9-11-16(12-10-15)27-32(29,30)18-8-6-7-17-21(18)26-31-25-17/h6-13,27H,4-5H2,1-3H3,(H,22,23,24) |
| InChIKey | WDGMBSIMABUPBJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|