C17H17N5O2 — CID 122301225
(E)-3-(furan-2-yl)-N-[2-(2,4,5-trimethylimidazol-1-yl)pyrimidin-5-yl]prop-2-enamide (PubChem CID 122301225) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[2-(2,4,5-trimethylimidazol-1-yl)pyrimidin-5-yl]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[2-(2,4,5-trimethylimidazol-1-yl)pyrimidin-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 122301225 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[2-(2,4,5-trimethylimidazol-1-yl)pyrimidin-5-yl]prop-2-enamide |
| SMILES | Cc1nc(C)n(-c2ncc(NC(=O)/C=C/c3ccco3)cn2)c1C |
| InChI | InChI=1S/C17H17N5O2/c1-11-12(2)22(13(3)20-11)17-18-9-14(10-19-17)21-16(23)7-6-15-5-4-8-24-15/h4-10H,1-3H3,(H,21,23)/b7-6+ |
| InChIKey | CRYQXCCBLZLWHC-VOTSOKGWSA-N |
| XLogP | 2.83 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|