C11H16N6O3S — CID 122319559
N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-1-methylimidazole-4-sulfonamide (PubChem CID 122319559) has the molecular formula C11H16N6O3S and a molecular weight of 312.36 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 122319559 |
| Molecular Formula | C11H16N6O3S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-1-methylimidazole-4-sulfonamide |
| SMILES | COc1ncc(NS(=O)(=O)c2cn(C)cn2)c(N(C)C)n1 |
| InChI | InChI=1S/C11H16N6O3S/c1-16(2)10-8(5-12-11(14-10)20-4)15-21(18,19)9-6-17(3)7-13-9/h5-7,15H,1-4H3 |
| InChIKey | MJJVEOFNMRCURK-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |