C13H15FN4O3S — CID 122319347
N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-4-fluorobenzenesulfonamide (PubChem CID 122319347) has the molecular formula C13H15FN4O3S and a molecular weight of 326.35 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 122319347 |
| Molecular Formula | C13H15FN4O3S |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-[4-(dimethylamino)-2-methoxypyrimidin-5-yl]-4-fluorobenzenesulfonamide |
| SMILES | COc1ncc(NS(=O)(=O)c2ccc(F)cc2)c(N(C)C)n1 |
| InChI | InChI=1S/C13H15FN4O3S/c1-18(2)12-11(8-15-13(16-12)21-3)17-22(19,20)10-6-4-9(14)5-7-10/h4-8,17H,1-3H3 |
| InChIKey | IRMSDHPWUULSQY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |