C17H13BrF3NO2S — CID 122329922
[2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 122329922) has the molecular formula C17H13BrF3NO2S and a molecular weight of 432.26 g/mol. Its IUPAC name is [2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 122329922 |
| Molecular Formula | C17H13BrF3NO2S |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | [2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | COc1ccc(C2SCCN2C(=O)c2ccc(F)c(F)c2F)cc1Br |
| InChI | InChI=1S/C17H13BrF3NO2S/c1-24-13-5-2-9(8-11(13)18)17-22(6-7-25-17)16(23)10-3-4-12(19)15(21)14(10)20/h2-5,8,17H,6-7H2,1H3 |
| InChIKey | GSOVSWLBGLIXFU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|