C19H17BrClNO2S — CID 122329964
(E)-1-[2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-yl]-3-(4-chlorophenyl)prop-2-en-1-one (PubChem CID 122329964) has the molecular formula C19H17BrClNO2S and a molecular weight of 438.77 g/mol. Its IUPAC name is (E)-1-[2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-yl]-3-(4-chlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-yl]-3-(4-chlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 122329964 |
| Molecular Formula | C19H17BrClNO2S |
| Molecular Weight | 438.77 g/mol |
| Exact Mass | 436.99 |
| IUPAC Name | (E)-1-[2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-yl]-3-(4-chlorophenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C2SCCN2C(=O)/C=C/c2ccc(Cl)cc2)cc1Br |
| InChI | InChI=1S/C19H17BrClNO2S/c1-24-17-8-5-14(12-16(17)20)19-22(10-11-25-19)18(23)9-4-13-2-6-15(21)7-3-13/h2-9,12,19H,10-11H2,1H3/b9-4+ |
| InChIKey | OPTCRVIGZCEGQX-RUDMXATFSA-N |
| XLogP | 5.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.77 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|