C18H15BrN2O6S — CID 4063317
2-[2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidine-3-carbonyl]-6-nitrobenzoic acid (PubChem CID 4063317) has the molecular formula C18H15BrN2O6S and a molecular weight of 467.30 g/mol. Its IUPAC name is 2-[2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidine-3-carbonyl]-6-nitrobenzoic acid.
| Compound Name | 2-[2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidine-3-carbonyl]-6-nitrobenzoic acid |
|---|---|
| PubChem CID | 4063317 |
| Molecular Formula | C18H15BrN2O6S |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 465.98 |
| IUPAC Name | 2-[2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidine-3-carbonyl]-6-nitrobenzoic acid |
| SMILES | COc1ccc(C2SCCN2C(=O)c2cccc([N+](=O)[O-])c2C(=O)O)cc1Br |
| InChI | InChI=1S/C18H15BrN2O6S/c1-27-14-6-5-10(9-12(14)19)17-20(7-8-28-17)16(22)11-3-2-4-13(21(25)26)15(11)18(23)24/h2-6,9,17H,7-8H2,1H3,(H,23,24) |
| InChIKey | AHHVCFBYRVWLCH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|