C20H14Br2N2O6S — CID 23847938
6,8-dibromo-3-[2-(4-methoxy-3-nitrophenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one (PubChem CID 23847938) has the molecular formula C20H14Br2N2O6S and a molecular weight of 570.22 g/mol. Its IUPAC name is 6,8-dibromo-3-[2-(4-methoxy-3-nitrophenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one.
| Compound Name | 6,8-dibromo-3-[2-(4-methoxy-3-nitrophenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 23847938 |
| Molecular Formula | C20H14Br2N2O6S |
| Molecular Weight | 570.22 g/mol |
| Exact Mass | 567.89 |
| IUPAC Name | 6,8-dibromo-3-[2-(4-methoxy-3-nitrophenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one |
| SMILES | COc1ccc(C2SCCN2C(=O)c2cc3cc(Br)cc(Br)c3oc2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H14Br2N2O6S/c1-29-16-3-2-10(8-15(16)24(27)28)19-23(4-5-31-19)18(25)13-7-11-6-12(21)9-14(22)17(11)30-20(13)26/h2-3,6-9,19H,4-5H2,1H3 |
| InChIKey | NPNKRKRKRPASTK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 102.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.22 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|