C20H16BrNO4S — CID 4589668
3-[2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one (PubChem CID 4589668) has the molecular formula C20H16BrNO4S and a molecular weight of 446.32 g/mol. Its IUPAC name is 3-[2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one.
| Compound Name | 3-[2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 4589668 |
| Molecular Formula | C20H16BrNO4S |
| Molecular Weight | 446.32 g/mol |
| Exact Mass | 445.00 |
| IUPAC Name | 3-[2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one |
| SMILES | COc1ccc(C2SCCN2C(=O)c2cc3ccccc3oc2=O)cc1Br |
| InChI | InChI=1S/C20H16BrNO4S/c1-25-17-7-6-13(11-15(17)21)19-22(8-9-27-19)18(23)14-10-12-4-2-3-5-16(12)26-20(14)24/h2-7,10-11,19H,8-9H2,1H3 |
| InChIKey | MVJLDJBZDAMZEY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|