C17H20F3N5O3S — CID 122350710
N-ethyl-6-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]pyridazin-3-amine (PubChem CID 122350710) has the molecular formula C17H20F3N5O3S and a molecular weight of 431.44 g/mol. Its IUPAC name is N-ethyl-6-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]pyridazin-3-amine.
| Compound Name | N-ethyl-6-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]pyridazin-3-amine |
|---|---|
| PubChem CID | 122350710 |
| Molecular Formula | C17H20F3N5O3S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-ethyl-6-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]pyridazin-3-amine |
| SMILES | CCNc1ccc(N2CCN(S(=O)(=O)c3ccc(OC(F)(F)F)cc3)CC2)nn1 |
| InChI | InChI=1S/C17H20F3N5O3S/c1-2-21-15-7-8-16(23-22-15)24-9-11-25(12-10-24)29(26,27)14-5-3-13(4-6-14)28-17(18,19)20/h3-8H,2,9-12H2,1H3,(H,21,22) |
| InChIKey | JBQSEUNLQCGKGG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |