C17H22FN5O3S — CID 122350896
N-ethyl-6-[4-(5-fluoro-2-methoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-3-amine (PubChem CID 122350896) has the molecular formula C17H22FN5O3S and a molecular weight of 395.46 g/mol. Its IUPAC name is N-ethyl-6-[4-(5-fluoro-2-methoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-3-amine.
| Compound Name | N-ethyl-6-[4-(5-fluoro-2-methoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-3-amine |
|---|---|
| PubChem CID | 122350896 |
| Molecular Formula | C17H22FN5O3S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-ethyl-6-[4-(5-fluoro-2-methoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-3-amine |
| SMILES | CCNc1ccc(N2CCN(S(=O)(=O)c3cc(F)ccc3OC)CC2)nn1 |
| InChI | InChI=1S/C17H22FN5O3S/c1-3-19-16-6-7-17(21-20-16)22-8-10-23(11-9-22)27(24,25)15-12-13(18)4-5-14(15)26-2/h4-7,12H,3,8-11H2,1-2H3,(H,19,20) |
| InChIKey | PPLCLCDKADWSDN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |